C29H29BrN3O4+ — CID 15101215
2-(N-(5-bromo-1-ethylpyridin-1-ium-3-carbonyl)anilino)ethyl N-(2-naphthalen-1-yloxyethyl)carbamate (PubChem CID 15101215) has the molecular formula C29H29BrN3O4+ and a molecular weight of 563.47 g/mol. Its IUPAC name is 2-(N-(5-bromo-1-ethylpyridin-1-ium-3-carbonyl)anilino)ethyl N-(2-naphthalen-1-yloxyethyl)carbamate.
| Compound Name | 2-(N-(5-bromo-1-ethylpyridin-1-ium-3-carbonyl)anilino)ethyl N-(2-naphthalen-1-yloxyethyl)carbamate |
|---|---|
| PubChem CID | 15101215 |
| Molecular Formula | C29H29BrN3O4+ |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 2-(N-(5-bromo-1-ethylpyridin-1-ium-3-carbonyl)anilino)ethyl N-(2-naphthalen-1-yloxyethyl)carbamate |
| SMILES | CC[n+]1cc(Br)cc(C(=O)N(CCOC(=O)NCCOc2cccc3ccccc23)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28BrN3O4/c1-2-32-20-23(19-24(30)21-32)28(34)33(25-11-4-3-5-12-25)16-18-37-29(35)31-15-17-36-27-14-8-10-22-9-6-7-13-26(22)27/h3-14,19-21H,2,15-18H2,1H3/p+1 |
| InChIKey | XXKWVHBMOKVTNC-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|