C19H22BrN3O5 — CID 67868188
2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate (PubChem CID 67868188) has the molecular formula C19H22BrN3O5 and a molecular weight of 452.31 g/mol. Its IUPAC name is 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate.
| Compound Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 67868188 |
| Molecular Formula | C19H22BrN3O5 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-[2-(2-hydroxyethoxy)ethyl]carbamate |
| SMILES | O=C(NCCOCCO)OCCN(C(=O)c1cncc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22BrN3O5/c20-16-12-15(13-21-14-16)18(25)23(17-4-2-1-3-5-17)7-10-28-19(26)22-6-9-27-11-8-24/h1-5,12-14,24H,6-11H2,(H,22,26) |
| InChIKey | UKKDUXZPHCCEML-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|