C23H22BrN3O4 — CID 67868615
2-phenoxyethyl N-[2-[(5-bromopyridine-3-carbonyl)amino]ethyl]-N-phenylcarbamate (PubChem CID 67868615) has the molecular formula C23H22BrN3O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 2-phenoxyethyl N-[2-[(5-bromopyridine-3-carbonyl)amino]ethyl]-N-phenylcarbamate.
| Compound Name | 2-phenoxyethyl N-[2-[(5-bromopyridine-3-carbonyl)amino]ethyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 67868615 |
| Molecular Formula | C23H22BrN3O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-phenoxyethyl N-[2-[(5-bromopyridine-3-carbonyl)amino]ethyl]-N-phenylcarbamate |
| SMILES | O=C(NCCN(C(=O)OCCOc1ccccc1)c1ccccc1)c1cncc(Br)c1 |
| InChI | InChI=1S/C23H22BrN3O4/c24-19-15-18(16-25-17-19)22(28)26-11-12-27(20-7-3-1-4-8-20)23(29)31-14-13-30-21-9-5-2-6-10-21/h1-10,15-17H,11-14H2,(H,26,28) |
| InChIKey | QJYDRBKOBFSELZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|