C18H20BrN3O4 — CID 67868521
2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)-N-methylcarbamate (PubChem CID 67868521) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)-N-methylcarbamate.
| Compound Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 67868521 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)-N-methylcarbamate |
| SMILES | CN(CCO)C(=O)OCCN(C(=O)c1cncc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C18H20BrN3O4/c1-21(7-9-23)18(25)26-10-8-22(16-5-3-2-4-6-16)17(24)14-11-15(19)13-20-12-14/h2-6,11-13,23H,7-10H2,1H3 |
| InChIKey | JNJWXYLXRDGYNJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |