C22H19BrFN3O3 — CID 67843879
(4-fluorophenyl)methyl N-[2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl]carbamate (PubChem CID 67843879) has the molecular formula C22H19BrFN3O3 and a molecular weight of 472.31 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-[2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl]carbamate.
| Compound Name | (4-fluorophenyl)methyl N-[2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl]carbamate |
|---|---|
| PubChem CID | 67843879 |
| Molecular Formula | C22H19BrFN3O3 |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (4-fluorophenyl)methyl N-[2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl]carbamate |
| SMILES | O=C(NCCN(C(=O)c1cncc(Br)c1)c1ccccc1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H19BrFN3O3/c23-18-12-17(13-25-14-18)21(28)27(20-4-2-1-3-5-20)11-10-26-22(29)30-15-16-6-8-19(24)9-7-16/h1-9,12-14H,10-11,15H2,(H,26,29) |
| InChIKey | MHYHEVCTWSHBLT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |