C17H18BrN3O4 — CID 67868740
2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)carbamate (PubChem CID 67868740) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)carbamate.
| Compound Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 67868740 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-(N-(5-bromopyridine-3-carbonyl)anilino)ethyl N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(NCCO)OCCN(C(=O)c1cncc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C17H18BrN3O4/c18-14-10-13(11-19-12-14)16(23)21(15-4-2-1-3-5-15)7-9-25-17(24)20-6-8-22/h1-5,10-12,22H,6-9H2,(H,20,24) |
| InChIKey | HWKOPSYFSVIRIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |