C31H36BrClN4O4 — CID 22162966
3-[N-[3-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]propanoyl]anilino]propyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate chloride (PubChem CID 22162966) has the molecular formula C31H36BrClN4O4 and a molecular weight of 644.01 g/mol. Its IUPAC name is 3-[N-[3-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]propanoyl]anilino]propyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate chloride.
| Compound Name | 3-[N-[3-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]propanoyl]anilino]propyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate chloride |
|---|---|
| PubChem CID | 22162966 |
| Molecular Formula | C31H36BrClN4O4 |
| Molecular Weight | 644.01 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 3-[N-[3-[(5-bromo-1-propylpyridin-1-ium-3-carbonyl)amino]propanoyl]anilino]propyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate chloride |
| SMILES | CCC[n+]1cc(Br)cc(C(=O)NCCC(=O)N(CCCOC(=O)C2NCCc3ccccc32)c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C31H35BrN4O4.ClH/c1-2-17-35-21-24(20-25(32)22-35)30(38)34-16-14-28(37)36(26-10-4-3-5-11-26)18-8-19-40-31(39)29-27-12-7-6-9-23(27)13-15-33-29;/h3-7,9-12,20-22,29,33H,2,8,13-19H2,1H3;1H |
| InChIKey | LIIQDOHSIGEMJF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.01 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|