C15H30O10P2 — CID 22165761
3,9-bis[2-(2-methoxyethoxy)ethoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 22165761) has the molecular formula C15H30O10P2 and a molecular weight of 432.34 g/mol. Its IUPAC name is 3,9-bis[2-(2-methoxyethoxy)ethoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[2-(2-methoxyethoxy)ethoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22165761 |
| Molecular Formula | C15H30O10P2 |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3,9-bis[2-(2-methoxyethoxy)ethoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | COCCOCCOP1OCC2(CO1)COP(OCCOCCOC)OC2 |
| InChI | InChI=1S/C15H30O10P2/c1-16-3-5-18-7-9-20-26-22-11-15(12-23-26)13-24-27(25-14-15)21-10-8-19-6-4-17-2/h3-14H2,1-2H3 |
| InChIKey | CRNIWLWTNIFNJY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|