C17H11F3N2O2 — CID 22166030
(5Z)-3-(2,5-difluorophenyl)-5-[(2-fluorophenyl)methylidene]-1-methylimidazolidine-2,4-dione (PubChem CID 22166030) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is (5Z)-3-(2,5-difluorophenyl)-5-[(2-fluorophenyl)methylidene]-1-methylimidazolidine-2,4-dione.
| Compound Name | (5Z)-3-(2,5-difluorophenyl)-5-[(2-fluorophenyl)methylidene]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22166030 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (5Z)-3-(2,5-difluorophenyl)-5-[(2-fluorophenyl)methylidene]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2cc(F)ccc2F)C(=O)/C1=C/c1ccccc1F |
| InChI | InChI=1S/C17H11F3N2O2/c1-21-15(8-10-4-2-3-5-12(10)19)16(23)22(17(21)24)14-9-11(18)6-7-13(14)20/h2-9H,1H3/b15-8- |
| InChIKey | HUGKWVOQIBMCPZ-NVNXTCNLSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|