C19H24NO2+ — CID 22166083
2-benzyl-2-ethyl-5,6-dimethoxy-1,3-dihydroisoindol-2-ium (PubChem CID 22166083) has the molecular formula C19H24NO2+ and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-benzyl-2-ethyl-5,6-dimethoxy-1,3-dihydroisoindol-2-ium.
| Compound Name | 2-benzyl-2-ethyl-5,6-dimethoxy-1,3-dihydroisoindol-2-ium |
|---|---|
| PubChem CID | 22166083 |
| Molecular Formula | C19H24NO2+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-benzyl-2-ethyl-5,6-dimethoxy-1,3-dihydroisoindol-2-ium |
| SMILES | CC[N+]1(Cc2ccccc2)Cc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C19H24NO2/c1-4-20(12-15-8-6-5-7-9-15)13-16-10-18(21-2)19(22-3)11-17(16)14-20/h5-11H,4,12-14H2,1-3H3/q+1 |
| InChIKey | AMVHXRPGCDQDSE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|