C14H14N6O3S2 — CID 22166904
2-[(5-nitro-4-pyrrolidin-1-ylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole (PubChem CID 22166904) has the molecular formula C14H14N6O3S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[(5-nitro-4-pyrrolidin-1-ylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-[(5-nitro-4-pyrrolidin-1-ylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 22166904 |
| Molecular Formula | C14H14N6O3S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-[(5-nitro-4-pyrrolidin-1-ylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole |
| SMILES | O=[N+]([O-])c1cnc(CS(=O)c2nc3cscc3[nH]2)nc1N1CCCC1 |
| InChI | InChI=1S/C14H14N6O3S2/c21-20(22)11-5-15-12(18-13(11)19-3-1-2-4-19)8-25(23)14-16-9-6-24-7-10(9)17-14/h5-7H,1-4,8H2,(H,16,17) |
| InChIKey | XVRGRNUYXYHZOS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|