C44H56O5SSi — CID 22168188
methyl 2-[tert-butyl(diphenyl)silyl]oxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate (PubChem CID 22168188) has the molecular formula C44H56O5SSi and a molecular weight of 725.08 g/mol. Its IUPAC name is methyl 2-[tert-butyl(diphenyl)silyl]oxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate.
| Compound Name | methyl 2-[tert-butyl(diphenyl)silyl]oxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
|---|---|
| PubChem CID | 22168188 |
| Molecular Formula | C44H56O5SSi |
| Molecular Weight | 725.08 g/mol |
| Exact Mass | 724.36 |
| IUPAC Name | methyl 2-[tert-butyl(diphenyl)silyl]oxy-3-(3-methoxy-3-oxopropyl)sulfanyl-3-[2-(8-phenyloctyl)phenyl]propanoate |
| SMILES | COC(=O)CCSC(c1ccccc1CCCCCCCCc1ccccc1)C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C44H56O5SSi/c1-44(2,3)51(37-28-17-11-18-29-37,38-30-19-12-20-31-38)49-41(43(46)48-5)42(50-34-33-40(45)47-4)39-32-22-21-27-36(39)26-16-9-7-6-8-13-23-35-24-14-10-15-25-35/h10-12,14-15,17-22,24-25,27-32,41-42H,6-9,13,16,23,26,33-34H2,1-5H3 |
| InChIKey | LKUJITSPMCTPOB-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.08 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|