C16H19ClN2O — CID 22168438
2,4-dimethyl-3-(2-phenylethyl)pyridin-1-ium-1-carboxamide chloride (PubChem CID 22168438) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 2,4-dimethyl-3-(2-phenylethyl)pyridin-1-ium-1-carboxamide chloride.
| Compound Name | 2,4-dimethyl-3-(2-phenylethyl)pyridin-1-ium-1-carboxamide chloride |
|---|---|
| PubChem CID | 22168438 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2,4-dimethyl-3-(2-phenylethyl)pyridin-1-ium-1-carboxamide chloride |
| SMILES | Cc1cc[n+](C(N)=O)c(C)c1CCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C16H18N2O.ClH/c1-12-10-11-18(16(17)19)13(2)15(12)9-8-14-6-4-3-5-7-14;/h3-7,10-11H,8-9H2,1-2H3,(H-,17,19);1H |
| InChIKey | AHJABUYCCULDSS-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|