C13H13Cl2N3O3S2 — CID 22170635
2,4-dichloro-N-(5-propan-2-yl-1,3-thiazol-2-yl)-5-sulfamoylbenzamide (PubChem CID 22170635) has the molecular formula C13H13Cl2N3O3S2 and a molecular weight of 394.31 g/mol. Its IUPAC name is 2,4-dichloro-N-(5-propan-2-yl-1,3-thiazol-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-(5-propan-2-yl-1,3-thiazol-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 22170635 |
| Molecular Formula | C13H13Cl2N3O3S2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 2,4-dichloro-N-(5-propan-2-yl-1,3-thiazol-2-yl)-5-sulfamoylbenzamide |
| SMILES | CC(C)c1cnc(NC(=O)c2cc(S(N)(=O)=O)c(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N3O3S2/c1-6(2)10-5-17-13(22-10)18-12(19)7-3-11(23(16,20)21)9(15)4-8(7)14/h3-6H,1-2H3,(H2,16,20,21)(H,17,18,19) |
| InChIKey | RATGRPZCYKRQLG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |