C14H10Cl2F3NO6S — CID 22175493
ethyl 6,7-dichloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate (PubChem CID 22175493) has the molecular formula C14H10Cl2F3NO6S and a molecular weight of 448.20 g/mol. Its IUPAC name is ethyl 6,7-dichloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate.
| Compound Name | ethyl 6,7-dichloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22175493 |
| Molecular Formula | C14H10Cl2F3NO6S |
| Molecular Weight | 448.20 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | ethyl 6,7-dichloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)c2cc(Cl)c(Cl)cc2c(=O)n1C |
| InChI | InChI=1S/C14H10Cl2F3NO6S/c1-3-25-13(22)10-11(26-27(23,24)14(17,18)19)6-4-8(15)9(16)5-7(6)12(21)20(10)2/h4-5H,3H2,1-2H3 |
| InChIKey | XAZOTYVKOBYAPF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|