C14H11ClF3NO6S — CID 22175806
ethyl 6-chloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate (PubChem CID 22175806) has the molecular formula C14H11ClF3NO6S and a molecular weight of 413.76 g/mol. Its IUPAC name is ethyl 6-chloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22175806 |
| Molecular Formula | C14H11ClF3NO6S |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | ethyl 6-chloro-2-methyl-1-oxo-4-(trifluoromethylsulfonyloxy)isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)c2cc(Cl)ccc2c(=O)n1C |
| InChI | InChI=1S/C14H11ClF3NO6S/c1-3-24-13(21)10-11(25-26(22,23)14(16,17)18)9-6-7(15)4-5-8(9)12(20)19(10)2/h4-6H,3H2,1-2H3 |
| InChIKey | QFECXBKHIMTNIV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|