C27H27NO3 — CID 22175799
3-(hydroxymethyl)-2-(2-methylpropyl)-4-phenyl-6-phenylmethoxyisoquinolin-1-one (PubChem CID 22175799) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2-(2-methylpropyl)-4-phenyl-6-phenylmethoxyisoquinolin-1-one.
| Compound Name | 3-(hydroxymethyl)-2-(2-methylpropyl)-4-phenyl-6-phenylmethoxyisoquinolin-1-one |
|---|---|
| PubChem CID | 22175799 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-(hydroxymethyl)-2-(2-methylpropyl)-4-phenyl-6-phenylmethoxyisoquinolin-1-one |
| SMILES | CC(C)Cn1c(CO)c(-c2ccccc2)c2cc(OCc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C27H27NO3/c1-19(2)16-28-25(17-29)26(21-11-7-4-8-12-21)24-15-22(13-14-23(24)27(28)30)31-18-20-9-5-3-6-10-20/h3-15,19,29H,16-18H2,1-2H3 |
| InChIKey | JCINJCVKDXRFPC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |