C22H23NO5 — CID 54725309
methyl 4-hydroxy-2-(2-methylpropyl)-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate (PubChem CID 54725309) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 4-hydroxy-2-(2-methylpropyl)-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate.
| Compound Name | methyl 4-hydroxy-2-(2-methylpropyl)-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54725309 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 4-hydroxy-2-(2-methylpropyl)-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(O)c2ccc(OCc3ccccc3)cc2c(=O)n1CC(C)C |
| InChI | InChI=1S/C22H23NO5/c1-14(2)12-23-19(22(26)27-3)20(24)17-10-9-16(11-18(17)21(23)25)28-13-15-7-5-4-6-8-15/h4-11,14,24H,12-13H2,1-3H3 |
| InChIKey | FSAOKGFDDGUZKD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |