C35H30N2O5 — CID 91512111
4-hydroxy-2-[[2-(2-methylpropyl)-1-oxo-4-phenyl-7-phenylmethoxyisoquinolin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 91512111) has the molecular formula C35H30N2O5 and a molecular weight of 558.63 g/mol. Its IUPAC name is 4-hydroxy-2-[[2-(2-methylpropyl)-1-oxo-4-phenyl-7-phenylmethoxyisoquinolin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 4-hydroxy-2-[[2-(2-methylpropyl)-1-oxo-4-phenyl-7-phenylmethoxyisoquinolin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91512111 |
| Molecular Formula | C35H30N2O5 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 4-hydroxy-2-[[2-(2-methylpropyl)-1-oxo-4-phenyl-7-phenylmethoxyisoquinolin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CC(C)Cn1c(CN2C(=O)c3cccc(O)c3C2=O)c(-c2ccccc2)c2ccc(OCc3ccccc3)cc2c1=O |
| InChI | InChI=1S/C35H30N2O5/c1-22(2)19-36-29(20-37-33(39)27-14-9-15-30(38)32(27)35(37)41)31(24-12-7-4-8-13-24)26-17-16-25(18-28(26)34(36)40)42-21-23-10-5-3-6-11-23/h3-18,22,38H,19-21H2,1-2H3 |
| InChIKey | BSIJLVNKJVGLQA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|