2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid

C12H12O6 — CID 22180864

IUPAC2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid
SMILESCOc1cc(C(=O)O)c2cc(CO)oc2c1OC
InChIInChI=1S/C12H12O6/c1-16-9-4-8(12(14)15)7-3-6(5-13)18-10(7)11(9)17-2/h3-4,13H,5H2,1-2H3,(H,14,15)
InChIKeyMTDFEQZPSBHGRU-UHFFFAOYSA-N
MW252.22 g/mol
LogP1.64
Rot. Bonds4

About 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid

2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid (PubChem CID 22180864) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid.

Molecular Properties

Compound Name2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid
PubChem CID22180864
Molecular FormulaC12H12O6
Molecular Weight252.22 g/mol
Exact Mass252.06
IUPAC Name2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid
SMILESCOc1cc(C(=O)O)c2cc(CO)oc2c1OC
InChIInChI=1S/C12H12O6/c1-16-9-4-8(12(14)15)7-3-6(5-13)18-10(7)11(9)17-2/h3-4,13H,5H2,1-2H3,(H,14,15)
InChIKeyMTDFEQZPSBHGRU-UHFFFAOYSA-N
XLogP1.64
TPSA89.13 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.22
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid?
The IUPAC name of 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid (CID 22180864) is 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid.
What is the SMILES notation for 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid?
The canonical SMILES for 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid is COc1cc(C(=O)O)c2cc(CO)oc2c1OC.
What is the InChIKey of 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid?
The InChIKey is MTDFEQZPSBHGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O6/c1-16-9-4-8(12(14)15)7-3-6(5-13)18-10(7)11(9)17-2/h3-4,13H,5H2,1-2H3,(H,14,15).
What are the key properties of 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid?
2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid has a molecular weight of 252.22 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6,7-dimethoxy-1-benzofuran-4-carboxylic acid is sourced from PubChem (CID 22180864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).