C14H20O7 — CID 89405570
2-[(2R,3S)-3,4-dihydroxybutan-2-yl]-3,4,5-trimethoxybenzoic acid (PubChem CID 89405570) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[(2R,3S)-3,4-dihydroxybutan-2-yl]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[(2R,3S)-3,4-dihydroxybutan-2-yl]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 89405570 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-[(2R,3S)-3,4-dihydroxybutan-2-yl]-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c([C@@H](C)[C@H](O)CO)c(OC)c1OC |
| InChI | InChI=1S/C14H20O7/c1-7(9(16)6-15)11-8(14(17)18)5-10(19-2)12(20-3)13(11)21-4/h5,7,9,15-16H,6H2,1-4H3,(H,17,18)/t7-,9+/m0/s1 |
| InChIKey | ZTIJTZXWKAWRDQ-IONNQARKSA-N |
| XLogP | 0.87 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |