C20H25NO5 — CID 88821670
2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid (PubChem CID 88821670) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 88821670 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid |
| SMILES | CCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C(C)c1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c1-6-21(13(2)14-10-8-7-9-11-14)17-15(20(22)23)12-16(24-3)18(25-4)19(17)26-5/h7-13H,6H2,1-5H3,(H,22,23) |
| InChIKey | CZFJXTWGWSCRBP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|