2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid

C20H25NO5 — CID 88821670

IUPAC2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid
SMILESCCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C(C)c1ccccc1
InChIInChI=1S/C20H25NO5/c1-6-21(13(2)14-10-8-7-9-11-14)17-15(20(22)23)12-16(24-3)18(25-4)19(17)26-5/h7-13H,6H2,1-5H3,(H,22,23)
InChIKeyCZFJXTWGWSCRBP-UHFFFAOYSA-N
MW359.42 g/mol
LogP4.00
Rot. Bonds8

About 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid

2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid (PubChem CID 88821670) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid.

Molecular Properties

Compound Name2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid
PubChem CID88821670
Molecular FormulaC20H25NO5
Molecular Weight359.42 g/mol
Exact Mass359.17
IUPAC Name2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid
SMILESCCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C(C)c1ccccc1
InChIInChI=1S/C20H25NO5/c1-6-21(13(2)14-10-8-7-9-11-14)17-15(20(22)23)12-16(24-3)18(25-4)19(17)26-5/h7-13H,6H2,1-5H3,(H,22,23)
InChIKeyCZFJXTWGWSCRBP-UHFFFAOYSA-N
XLogP4.00
TPSA68.23 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.42
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}

Analyze 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid?
The IUPAC name of 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid (CID 88821670) is 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid.
What is the SMILES notation for 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid?
The canonical SMILES for 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid is CCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C(C)c1ccccc1.
What is the InChIKey of 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid?
The InChIKey is CZFJXTWGWSCRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO5/c1-6-21(13(2)14-10-8-7-9-11-14)17-15(20(22)23)12-16(24-3)18(25-4)19(17)26-5/h7-13H,6H2,1-5H3,(H,22,23).
What are the key properties of 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid?
2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid has a molecular weight of 359.42 g/mol, XLogP of 4.00, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(1-phenylethyl)amino]-3,4,5-trimethoxybenzoic acid is sourced from PubChem (CID 88821670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).