C22H27NO6 — CID 9417850
[(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2,3,4-trimethoxybenzoate (PubChem CID 9417850) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 9417850 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(1R)-2-(diethylamino)-2-oxo-1-phenylethyl] 2,3,4-trimethoxybenzoate |
| SMILES | CCN(CC)C(=O)[C@H](OC(=O)c1ccc(OC)c(OC)c1OC)c1ccccc1 |
| InChI | InChI=1S/C22H27NO6/c1-6-23(7-2)21(24)18(15-11-9-8-10-12-15)29-22(25)16-13-14-17(26-3)20(28-5)19(16)27-4/h8-14,18H,6-7H2,1-5H3/t18-/m1/s1 |
| InChIKey | YVAKEPJEAQTUJN-GOSISDBHSA-N |
| XLogP | 3.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |