About 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid
2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid (PubChem CID 88822201) has the molecular formula C17H25NO5
and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid.
Molecular Properties
| Compound Name | 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid |
| PubChem CID | 88822201 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid |
| SMILES | CCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C1CCCC1 |
| InChI | InChI=1S/C17H25NO5/c1-5-18(11-8-6-7-9-11)14-12(17(19)20)10-13(21-2)15(22-3)16(14)23-4/h10-11H,5-9H2,1-4H3,(H,19,20) |
| InChIKey | JBNASKOGHNDVPN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid?
The IUPAC name of 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid (CID 88822201) is 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid.
What is the SMILES notation for 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid?
The canonical SMILES for 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid is CCN(c1c(C(=O)O)cc(OC)c(OC)c1OC)C1CCCC1.
What is the InChIKey of 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid?
The InChIKey is JBNASKOGHNDVPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO5/c1-5-18(11-8-6-7-9-11)14-12(17(19)20)10-13(21-2)15(22-3)16(14)23-4/h10-11H,5-9H2,1-4H3,(H,19,20).
What are the key properties of 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid?
2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid has a molecular weight of 323.39 g/mol, XLogP of 3.18, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl(ethyl)amino]-3,4,5-trimethoxybenzoic acid is sourced from PubChem (CID 88822201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).