C14H10Cl2FN3O2S2 — CID 22204232
5-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide (PubChem CID 22204232) has the molecular formula C14H10Cl2FN3O2S2 and a molecular weight of 406.29 g/mol. Its IUPAC name is 5-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22204232 |
| Molecular Formula | C14H10Cl2FN3O2S2 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | 5-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccn(Cc2c(F)cccc2Cl)n1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H10Cl2FN3O2S2/c15-10-2-1-3-11(17)9(10)8-20-7-6-13(18-20)19-24(21,22)14-5-4-12(16)23-14/h1-7H,8H2,(H,18,19) |
| InChIKey | FKDTWJBUIBHTFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |