C16H10Cl4FN3O2S — CID 22204243
2,4,5-trichloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]benzenesulfonamide (PubChem CID 22204243) has the molecular formula C16H10Cl4FN3O2S and a molecular weight of 469.15 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22204243 |
| Molecular Formula | C16H10Cl4FN3O2S |
| Molecular Weight | 469.15 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 2,4,5-trichloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccn(Cc2c(F)cccc2Cl)n1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl4FN3O2S/c17-10-2-1-3-14(21)9(10)8-24-5-4-16(22-24)23-27(25,26)15-7-12(19)11(18)6-13(15)20/h1-7H,8H2,(H,22,23) |
| InChIKey | LPOAEZSTCXQLTL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.15 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|