C15H10Cl2NO4- — CID 22215636
2-(2,6-dichloro-4-nitrophenyl)-3-phenylpropanoate (PubChem CID 22215636) has the molecular formula C15H10Cl2NO4- and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-nitrophenyl)-3-phenylpropanoate.
| Compound Name | 2-(2,6-dichloro-4-nitrophenyl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 22215636 |
| Molecular Formula | C15H10Cl2NO4- |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-(2,6-dichloro-4-nitrophenyl)-3-phenylpropanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO4/c16-12-7-10(18(21)22)8-13(17)14(12)11(15(19)20)6-9-4-2-1-3-5-9/h1-5,7-8,11H,6H2,(H,19,20)/p-1 |
| InChIKey | SNEKYXQUJYBINY-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|