C20H24N2OS — CID 22217311
2-[1-(4-tert-butylphenoxy)ethylsulfanyl]-6-methyl-1H-benzimidazole (PubChem CID 22217311) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenoxy)ethylsulfanyl]-6-methyl-1H-benzimidazole.
| Compound Name | 2-[1-(4-tert-butylphenoxy)ethylsulfanyl]-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 22217311 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[1-(4-tert-butylphenoxy)ethylsulfanyl]-6-methyl-1H-benzimidazole |
| SMILES | Cc1ccc2nc(SC(C)Oc3ccc(C(C)(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H24N2OS/c1-13-6-11-17-18(12-13)22-19(21-17)24-14(2)23-16-9-7-15(8-10-16)20(3,4)5/h6-12,14H,1-5H3,(H,21,22) |
| InChIKey | ANYVFKYSIYJAJZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|