C12H17N3OS — CID 64898748
3-amino-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butan-1-ol (PubChem CID 64898748) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-amino-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butan-1-ol.
| Compound Name | 3-amino-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 64898748 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-amino-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]butan-1-ol |
| SMILES | Cc1ccc2nc(SC(CO)C(C)N)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3OS/c1-7-3-4-9-10(5-7)15-12(14-9)17-11(6-16)8(2)13/h3-5,8,11,16H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | SRPXOKQBCJFYOO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |