About aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate
aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate (PubChem CID 22251246) has the molecular formula C32H25AlN2O3
and a molecular weight of 512.55 g/mol. Its IUPAC name is aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate.
Molecular Properties
| Compound Name | aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate |
| PubChem CID | 22251246 |
| Molecular Formula | C32H25AlN2O3 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate |
| SMILES | Cc1ccc2cccc([O-])c2n1.Cc1ccc2cccc([O-])c2n1.[Al+3].[O-]c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H10O.2C10H9NO.Al/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-9,13H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | WDIXNURAWJTREU-UHFFFAOYSA-K |
| XLogP | 5.28 |
| TPSA | 94.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate?
The IUPAC name of aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate (CID 22251246) is aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate.
What is the SMILES notation for aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate?
The canonical SMILES for aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate is Cc1ccc2cccc([O-])c2n1.Cc1ccc2cccc([O-])c2n1.[Al+3].[O-]c1cccc(-c2ccccc2)c1.
What is the InChIKey of aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate?
The InChIKey is WDIXNURAWJTREU-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H10O.2C10H9NO.Al/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-9,13H;2*2-6,12H,1H3;/q;;;+3/p-3.
What are the key properties of aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate?
aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate has a molecular weight of 512.55 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;bis(2-methylquinolin-8-olate);3-phenylphenolate is sourced from PubChem (CID 22251246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).