C23H25Cl2N3O2S3 — CID 22253968
2,6-dichloro-N-[6-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)hexyl]benzenesulfonamide (PubChem CID 22253968) has the molecular formula C23H25Cl2N3O2S3 and a molecular weight of 542.58 g/mol. Its IUPAC name is 2,6-dichloro-N-[6-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)hexyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[6-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22253968 |
| Molecular Formula | C23H25Cl2N3O2S3 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 2,6-dichloro-N-[6-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)hexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCCNc1nc2c(s1)CCSc1ccccc1-2)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H25Cl2N3O2S3/c24-17-9-7-10-18(25)22(17)33(29,30)27-14-6-2-1-5-13-26-23-28-21-16-8-3-4-11-19(16)31-15-12-20(21)32-23/h3-4,7-11,27H,1-2,5-6,12-15H2,(H,26,28) |
| InChIKey | KOYCPYKJMGMDGT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|