C22H24FN3O2S3 — CID 22254097
N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]-2-fluorobenzenesulfonamide (PubChem CID 22254097) has the molecular formula C22H24FN3O2S3 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22254097 |
| Molecular Formula | C22H24FN3O2S3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCNc1nc2c(s1)CCSc1ccccc1-2)c1ccccc1F |
| InChI | InChI=1S/C22H24FN3O2S3/c23-17-9-3-5-11-20(17)31(27,28)25-14-7-1-6-13-24-22-26-21-16-8-2-4-10-18(16)29-15-12-19(21)30-22/h2-5,8-11,25H,1,6-7,12-15H2,(H,24,26) |
| InChIKey | IKTLRKXLQPABPG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|