C21H21F2N3O2S3 — CID 22254102
N-[4-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)butyl]-2,4-difluorobenzenesulfonamide (PubChem CID 22254102) has the molecular formula C21H21F2N3O2S3 and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[4-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)butyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)butyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22254102 |
| Molecular Formula | C21H21F2N3O2S3 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[4-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)butyl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCNc1nc2c(s1)CCSc1ccccc1-2)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H21F2N3O2S3/c22-14-7-8-19(16(23)13-14)31(27,28)25-11-4-3-10-24-21-26-20-15-5-1-2-6-17(15)29-12-9-18(20)30-21/h1-2,5-8,13,25H,3-4,9-12H2,(H,24,26) |
| InChIKey | NCVFKOHAWUEMDS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|