C16H23N3O5 — CID 22269204
4-[[3-(4-carbamoylphenoxy)-2-hydroxypropyl]amino]piperidine-1-carboxylic acid (PubChem CID 22269204) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[[3-(4-carbamoylphenoxy)-2-hydroxypropyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-(4-carbamoylphenoxy)-2-hydroxypropyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22269204 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[[3-(4-carbamoylphenoxy)-2-hydroxypropyl]amino]piperidine-1-carboxylic acid |
| SMILES | NC(=O)c1ccc(OCC(O)CNC2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O5/c17-15(21)11-1-3-14(4-2-11)24-10-13(20)9-18-12-5-7-19(8-6-12)16(22)23/h1-4,12-13,18,20H,5-10H2,(H2,17,21)(H,22,23) |
| InChIKey | CSVIQHVMKIZHRN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |