C15H17F3N2O — CID 22279246
7-(methylamino)-6-(2-methylpropyl)-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 22279246) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 7-(methylamino)-6-(2-methylpropyl)-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-(methylamino)-6-(2-methylpropyl)-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22279246 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 7-(methylamino)-6-(2-methylpropyl)-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | CNc1cc2[nH]c(=O)cc(C(F)(F)F)c2cc1CC(C)C |
| InChI | InChI=1S/C15H17F3N2O/c1-8(2)4-9-5-10-11(15(16,17)18)6-14(21)20-13(10)7-12(9)19-3/h5-8,19H,4H2,1-3H3,(H,20,21) |
| InChIKey | FOVXQEOUJGKKHL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |