C16H17N2O4PS — CID 22280497
[2-[5-(2-methylpropyl)-2-pyridin-3-yl-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid (PubChem CID 22280497) has the molecular formula C16H17N2O4PS and a molecular weight of 364.36 g/mol. Its IUPAC name is [2-[5-(2-methylpropyl)-2-pyridin-3-yl-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid.
| Compound Name | [2-[5-(2-methylpropyl)-2-pyridin-3-yl-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 22280497 |
| Molecular Formula | C16H17N2O4PS |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-[5-(2-methylpropyl)-2-pyridin-3-yl-1,3-thiazol-4-yl]furan-3-yl]phosphonic acid |
| SMILES | CC(C)Cc1sc(-c2cccnc2)nc1-c1occc1P(=O)(O)O |
| InChI | InChI=1S/C16H17N2O4PS/c1-10(2)8-13-14(15-12(5-7-22-15)23(19,20)21)18-16(24-13)11-4-3-6-17-9-11/h3-7,9-10H,8H2,1-2H3,(H2,19,20,21) |
| InChIKey | DLBQWOPVIUGOPB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|