C12H16NO4PS — CID 50993358
[5-[2-methyl-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (PubChem CID 50993358) has the molecular formula C12H16NO4PS and a molecular weight of 301.30 g/mol. Its IUPAC name is [5-[2-methyl-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid.
| Compound Name | [5-[2-methyl-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 50993358 |
| Molecular Formula | C12H16NO4PS |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | [5-[2-methyl-5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| SMILES | Cc1nc(-c2ccc(P(=O)(O)O)o2)c(CC(C)C)s1 |
| InChI | InChI=1S/C12H16NO4PS/c1-7(2)6-10-12(13-8(3)19-10)9-4-5-11(17-9)18(14,15)16/h4-5,7H,6H2,1-3H3,(H2,14,15,16) |
| InChIKey | DCDMCCKVTDICCM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|