C15H28NO4P — CID 22281269
[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]-pentylphosphinic acid (PubChem CID 22281269) has the molecular formula C15H28NO4P and a molecular weight of 317.37 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]-pentylphosphinic acid.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]-pentylphosphinic acid |
|---|---|
| PubChem CID | 22281269 |
| Molecular Formula | C15H28NO4P |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]-pentylphosphinic acid |
| SMILES | CCCCCP(=O)(O)C1=CC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28NO4P/c1-5-6-7-10-21(18,19)13-9-8-12(11-13)16-14(17)20-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | OADMNDASDNVSIR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|