C15H27NO4P+ — CID 69104475
hydroxy-[5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]pentyl]-oxophosphanium (PubChem CID 69104475) has the molecular formula C15H27NO4P+ and a molecular weight of 316.36 g/mol. Its IUPAC name is hydroxy-[5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]pentyl]-oxophosphanium.
| Compound Name | hydroxy-[5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]pentyl]-oxophosphanium |
|---|---|
| PubChem CID | 69104475 |
| Molecular Formula | C15H27NO4P+ |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | hydroxy-[5-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopenten-1-yl]pentyl]-oxophosphanium |
| SMILES | CC(C)(C)OC(=O)NC1C=C(CCCCC[P+](=O)O)CC1 |
| InChI | InChI=1S/C15H26NO4P/c1-15(2,3)20-14(17)16-13-9-8-12(11-13)7-5-4-6-10-21(18)19/h11,13H,4-10H2,1-3H3,(H-,16,17,18,19)/p+1 |
| InChIKey | LFQVMLXASRZSBQ-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|