C19H14ClN5O4 — CID 22291663
1-[(2-chloro-4-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 22291663) has the molecular formula C19H14ClN5O4 and a molecular weight of 411.81 g/mol. Its IUPAC name is 1-[(2-chloro-4-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 1-[(2-chloro-4-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 22291663 |
| Molecular Formula | C19H14ClN5O4 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-[(2-chloro-4-nitrobenzoyl)amino]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C19H14ClN5O4/c20-15-9-11(25(28)29)6-8-13(15)19(27)23-24-17-12-4-2-1-3-10(12)5-7-14(17)16(22-24)18(21)26/h1-4,6,8-9H,5,7H2,(H2,21,26)(H,23,27) |
| InChIKey | KGFYJKYFJRJOFA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|