C18H24 — CID 22294456
(4S)-4-methylspiro[3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1,1'-cyclobutane] (PubChem CID 22294456) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (4S)-4-methylspiro[3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1,1'-cyclobutane].
| Compound Name | (4S)-4-methylspiro[3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1,1'-cyclobutane] |
|---|---|
| PubChem CID | 22294456 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (4S)-4-methylspiro[3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1,1'-cyclobutane] |
| SMILES | C[C@H]1CCC2(CCC2)C2CCc3ccccc3C21 |
| InChI | InChI=1S/C18H24/c1-13-9-12-18(10-4-11-18)16-8-7-14-5-2-3-6-15(14)17(13)16/h2-3,5-6,13,16-17H,4,7-12H2,1H3/t13-,16?,17?/m0/s1 |
| InChIKey | BBQQCVKNAKIAIT-IGEOTXOUSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |