C11H10Br2 — CID 12621746
1,1-dibromo-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene (PubChem CID 12621746) has the molecular formula C11H10Br2 and a molecular weight of 302.01 g/mol. Its IUPAC name is 1,1-dibromo-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene.
| Compound Name | 1,1-dibromo-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 12621746 |
| Molecular Formula | C11H10Br2 |
| Molecular Weight | 302.01 g/mol |
| Exact Mass | 299.91 |
| IUPAC Name | 1,1-dibromo-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalene |
| SMILES | BrC1(Br)C2CCc3ccccc3C21 |
| InChI | InChI=1S/C11H10Br2/c12-11(13)9-6-5-7-3-1-2-4-8(7)10(9)11/h1-4,9-10H,5-6H2 |
| InChIKey | UKKKUUREIJGVFS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|