C20H41N3O2 — CID 22294490
(2S)-2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide (PubChem CID 22294490) has the molecular formula C20H41N3O2 and a molecular weight of 355.57 g/mol. Its IUPAC name is (2S)-2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide.
| Compound Name | (2S)-2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 22294490 |
| Molecular Formula | C20H41N3O2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | (2S)-2-amino-N,N'-diheptyl-N,N'-dimethylbutanediamide |
| SMILES | CCCCCCCN(C)C(=O)C[C@H](N)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C20H41N3O2/c1-5-7-9-11-13-15-22(3)19(24)17-18(21)20(25)23(4)16-14-12-10-8-6-2/h18H,5-17,21H2,1-4H3/t18-/m0/s1 |
| InChIKey | VFVOJDQLLNNDQK-SFHVURJKSA-N |
| XLogP | 3.56 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|