C22H30N2O2 — CID 22296362
1-[(1R,10R,12R,18R,19R)-19-ethyl-6-methoxy-9,15-diazapentacyclo[10.5.2.01,10.03,8.015,18]nonadeca-3(8),4,6-trien-9-yl]ethanone (PubChem CID 22296362) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-[(1R,10R,12R,18R,19R)-19-ethyl-6-methoxy-9,15-diazapentacyclo[10.5.2.01,10.03,8.015,18]nonadeca-3(8),4,6-trien-9-yl]ethanone.
| Compound Name | 1-[(1R,10R,12R,18R,19R)-19-ethyl-6-methoxy-9,15-diazapentacyclo[10.5.2.01,10.03,8.015,18]nonadeca-3(8),4,6-trien-9-yl]ethanone |
|---|---|
| PubChem CID | 22296362 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[(1R,10R,12R,18R,19R)-19-ethyl-6-methoxy-9,15-diazapentacyclo[10.5.2.01,10.03,8.015,18]nonadeca-3(8),4,6-trien-9-yl]ethanone |
| SMILES | CC[C@@H]1[C@@H]2CCN3CC[C@@]4(Cc5ccc(OC)cc5N(C(C)=O)[C@@H]4C2)[C@@H]13 |
| InChI | InChI=1S/C22H30N2O2/c1-4-18-15-7-9-23-10-8-22(21(18)23)13-16-5-6-17(26-3)12-19(16)24(14(2)25)20(22)11-15/h5-6,12,15,18,20-21H,4,7-11,13H2,1-3H3/t15-,18-,20-,21-,22+/m1/s1 |
| InChIKey | AFGGAXVZNJUNFY-YKUXJPPJSA-N |
| XLogP | 3.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |