C22H26N2O5 — CID 163008448
1-(1-hydroxy-11-methoxy-4,23-dioxa-8,18-diazaheptacyclo[16.3.1.12,5.06,21.07,15.09,14.015,19]tricosa-9(14),10,12-trien-8-yl)ethanone (PubChem CID 163008448) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(1-hydroxy-11-methoxy-4,23-dioxa-8,18-diazaheptacyclo[16.3.1.12,5.06,21.07,15.09,14.015,19]tricosa-9(14),10,12-trien-8-yl)ethanone.
| Compound Name | 1-(1-hydroxy-11-methoxy-4,23-dioxa-8,18-diazaheptacyclo[16.3.1.12,5.06,21.07,15.09,14.015,19]tricosa-9(14),10,12-trien-8-yl)ethanone |
|---|---|
| PubChem CID | 163008448 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(1-hydroxy-11-methoxy-4,23-dioxa-8,18-diazaheptacyclo[16.3.1.12,5.06,21.07,15.09,14.015,19]tricosa-9(14),10,12-trien-8-yl)ethanone |
| SMILES | COc1ccc2c(c1)N(C(C)=O)C1C3C4OCC(O4)C4(O)CN5CCC21C5CC34 |
| InChI | InChI=1S/C22H26N2O5/c1-11(25)24-15-7-12(27-2)3-4-13(15)21-5-6-23-10-22(26)14(8-16(21)23)18(19(21)24)20-28-9-17(22)29-20/h3-4,7,14,16-20,26H,5-6,8-10H2,1-2H3 |
| InChIKey | IUGMVWCMVOLSFC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |