C23H26N2O5 — CID 12047364
(1R,5S,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one (PubChem CID 12047364) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (1R,5S,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one.
| Compound Name | (1R,5S,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one |
|---|---|
| PubChem CID | 12047364 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (1R,5S,7R,15R,16S)-17-acetyl-20-methoxy-4-methyl-10,13-dioxa-4,17-diazahexacyclo[14.7.0.01,5.07,15.08,12.018,23]tricosa-8(12),18(23),19,21-tetraen-9-one |
| SMILES | COc1ccc2c(c1)N(C(C)=O)[C@H]1[C@@H]3COC4=C(C(=O)OC4)[C@@H]3C[C@@H]3N(C)CC[C@@]231 |
| InChI | InChI=1S/C23H26N2O5/c1-12(26)25-17-8-13(28-3)4-5-16(17)23-6-7-24(2)19(23)9-14-15(21(23)25)10-29-18-11-30-22(27)20(14)18/h4-5,8,14-15,19,21H,6-7,9-11H2,1-3H3/t14-,15-,19+,21+,23-/m1/s1 |
| InChIKey | AEAVIJSUDOAYNT-XTNSEPEOSA-N |
| XLogP | 1.85 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |