C29H38O — CID 22296767
(8R,9S,10R,13S,14S)-10,13-dimethyl-4-naphthalen-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 22296767) has the molecular formula C29H38O and a molecular weight of 402.62 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-4-naphthalen-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-naphthalen-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22296767 |
| Molecular Formula | C29H38O |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-naphthalen-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCCC(c3cccc4ccccc34)C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C29H38O/c1-28-17-6-11-22(21-10-5-8-19-7-3-4-9-20(19)21)24(28)13-12-23-25-14-15-27(30)29(25,2)18-16-26(23)28/h3-5,7-10,22-27,30H,6,11-18H2,1-2H3/t22?,23-,24?,25-,26-,27?,28-,29-/m0/s1 |
| InChIKey | GVMWHULNKNYUHF-ZAPQOZKOSA-N |
| XLogP | 7.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |