C16H15F2N3O2S — CID 22299939
1-benzyl-1-[[4-(difluoromethoxy)benzoyl]amino]thiourea (PubChem CID 22299939) has the molecular formula C16H15F2N3O2S and a molecular weight of 351.38 g/mol. Its IUPAC name is 1-benzyl-1-[[4-(difluoromethoxy)benzoyl]amino]thiourea.
| Compound Name | 1-benzyl-1-[[4-(difluoromethoxy)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 22299939 |
| Molecular Formula | C16H15F2N3O2S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-benzyl-1-[[4-(difluoromethoxy)benzoyl]amino]thiourea |
| SMILES | NC(=S)N(Cc1ccccc1)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H15F2N3O2S/c17-15(18)23-13-8-6-12(7-9-13)14(22)20-21(16(19)24)10-11-4-2-1-3-5-11/h1-9,15H,10H2,(H2,19,24)(H,20,22) |
| InChIKey | NRQJBOPWMLYNDG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|