C13H18Cl2N2O3S — CID 22301237
N-butyl-2-(3,4-dichloro-2-methylsulfonylanilino)acetamide (PubChem CID 22301237) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is N-butyl-2-(3,4-dichloro-2-methylsulfonylanilino)acetamide.
| Compound Name | N-butyl-2-(3,4-dichloro-2-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 22301237 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-butyl-2-(3,4-dichloro-2-methylsulfonylanilino)acetamide |
| SMILES | CCCCNC(=O)CNc1ccc(Cl)c(Cl)c1S(C)(=O)=O |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-3-4-7-16-11(18)8-17-10-6-5-9(14)12(15)13(10)21(2,19)20/h5-6,17H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | WOOZDAUDGWJMIX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|