C25H27ClN2O5S2 — CID 22303801
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[2-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino]acetamide (PubChem CID 22303801) has the molecular formula C25H27ClN2O5S2 and a molecular weight of 535.09 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[2-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[2-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino]acetamide |
|---|---|
| PubChem CID | 22303801 |
| Molecular Formula | C25H27ClN2O5S2 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[2-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)c2cc(C)ccc2NCC(=O)NCCSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C25H27ClN2O5S2/c1-17-4-10-21(28-16-25(29)27-12-13-34-19-7-5-18(26)6-8-19)24(14-17)35(30,31)20-9-11-22(32-2)23(15-20)33-3/h4-11,14-15,28H,12-13,16H2,1-3H3,(H,27,29) |
| InChIKey | BFMLZCXPHJUUBO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|